Files
gomag-vending/vfp/nfjson/nfjsonread.prg
Marius Mutu 3a234b5240 Remove FXP files from tracking and update gitignore
- Remove nfjson/nfjsonread.FXP from git tracking
- Add Python cache patterns (__pycache__/, *.py[cod], *$py.class)
- Add environment file patterns (.env, .env.local, .env.*.local)
- Reorganize project structure with VFP files moved to vfp/ directory
- Add comprehensive database scripts and documentation

🤖 Generated with [Claude Code](https://claude.ai/code)

Co-Authored-By: Claude <noreply@anthropic.com>
2025-09-09 19:38:31 +03:00

776 lines
14 KiB
Plaintext
Raw Permalink Blame History

This file contains invisible Unicode characters

This file contains invisible Unicode characters that are indistinguishable to humans but may be processed differently by a computer. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.

*-------------------------------------------------------------------
* Created by Marco Plaza vfp2nofox@gmail.com / @vfp2Nofox
* ver 2.000 - 26/03/2016
* ver 2.090 - 22/07/2016 :
* improved error management
* nfjsonread will return .null. for invalid json
*-------------------------------------------------------------------
Lparameters cjsonstr,isFileName,reviveCollection
#Define crlf Chr(13)+Chr(10)
Private All
stackLevels=Astackinfo(aerrs)
If m.stackLevels > 1
calledFrom = 'called From '+aerrs(m.stackLevels-1,4)+' line '+Transform(aerrs(m.stackLevels-1,5))
Else
calledFrom = ''
Endif
oJson = nfJsonCreate2(cjsonstr,isFileName,reviveCollection)
Return Iif(Vartype(m.oJson)='O',m.oJson,.Null.)
*-------------------------------------------------------------------------
Function nfJsonCreate2(cjsonstr,isFileName,reviveCollection)
*-------------------------------------------------------------------------
* validate parameters:
Do Case
Case ;
Vartype(m.cjsonstr) # 'C' Or;
Vartype(m.reviveCollection) # 'L' Or ;
Vartype(m.isFileName) # 'L'
jERROR('invalid parameter type')
Case m.isFileName And !File(m.cjsonstr)
jERROR('File "'+Rtrim(Left(m.cjsonstr,255))+'" does not exist')
Endcase
* process json:
If m.isFileName
cjsonstr = Filetostr(m.cjsonstr)
Endif
cJson = Rtrim(Chrtran(m.cjsonstr,Chr(13)+Chr(9)+Chr(10),''))
pChar = Left(Ltrim(m.cJson),1)
nl = Alines(aj,m.cJson,20,'{','}','"',',',':','[',']')
For xx = 1 To Alen(aj)
If Left(Ltrim(aj(m.xx)),1) $ '{}",:[]' Or Left(Ltrim(m.aj(m.xx)),4) $ 'true/false/null'
aj(m.xx) = Ltrim(aj(m.xx))
Endif
Endfor
Try
x = 1
cError = ''
oStack = Createobject('stack')
oJson = Createobject('empty')
Do Case
Case aj(1)='{'
x = 1
oStack.pushObject()
procstring(m.oJson)
Case aj(1) = '['
x = 0
procstring(m.oJson,.T.)
Otherwise
Error 'Invalid Json: expecting [{ received '+m.pChar
Endcase
If m.reviveCollection
oJson = reviveCollection(m.oJson)
Endif
Catch To oerr
strp = ''
For Y = 1 To m.x
strp = m.strp+aj(m.y)
Endfor
Do Case
Case oerr.ErrorNo = 1098
cError = ' Invalid Json: '+ m.oerr.Message+crlf+' Parsing: '+Right(m.strp,80)
*+' program line: '+Transform(oerr.Lineno)+' array item '+Transform(m.x)
Case oerr.ErrorNo = 2034
cError = ' INVALID DATE: '+crlf+' Parsing: '+Right(m.strp,80)
Otherwise
cError = 'program error # '+Transform(m.oerr.ErrorNo)+crlf+m.oerr.Message+' at: '+Transform(oerr.Lineno)+crlf+' Parsing ('+Transform(m.x)+') '
Endcase
Endtry
If !Empty(m.cError)
jERROR(m.cError)
Endif
Return m.oJson
*------------------------------------------------
Procedure jERROR( cMessage )
*------------------------------------------------
Error 'nfJson ('+m.calledFrom+'):'+crlf+m.cMessage
Return To nfJsonRead
*--------------------------------------------------------------------------------
Procedure procstring(obj,eValue)
*--------------------------------------------------------------------------------
#Define cvalid 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890_'
#Define creem '_______________________________________________________________'
Private rowpos,colpos,bidim,ncols,arrayName,expecting,arrayLevel,vari
Private expectingPropertyName,expectingValue,objectOpen
expectingPropertyName = !m.eValue
expectingValue = m.eValue
expecting = Iif(expectingPropertyName,'"}','')
objectOpen = .T.
bidim = .F.
colpos = 0
rowpos = 0
arrayLevel = 0
arrayName = ''
vari = ''
ncols = 0
Do While m.objectOpen
x = m.x+1
Do Case
Case m.x > m.nl
m.x = m.nl
If oStack.Count > 0
Error 'expecting '+m.expecting
Endif
Return
Case aj(m.x) = '}' And '}' $ m.expecting
closeObject()
Case aj(x) = ']' And ']' $ m.expecting
closeArray()
Case m.expecting = ':'
If aj(m.x) = ':'
expecting = ''
Loop
Else
Error 'expecting : received '+aj(m.x)
Endif
Case ',' $ m.expecting
Do Case
Case aj(x) = ','
expecting = Iif( '[' $ m.expecting , '[' , '' )
Case Not aj(m.x) $ m.expecting
Error 'expecting '+m.expecting+' received '+aj(m.x)
Otherwise
expecting = Strtran(m.expecting,',','')
Endcase
Case m.expectingPropertyName
If aj(m.x) = '"'
propertyName(m.obj)
Else
Error 'expecting "'+m.expecting+' received '+aj(m.x)
Endif
Case m.expectingValue
If m.expecting == '[' And m.aj(m.x) # '['
Error 'expecting [ received '+aj(m.x)
Else
procValue(m.obj)
Endif
Endcase
Enddo
*----------------------------------------------------------
Function anuevoel(obj,arrayName,valasig,bidim,colpos,rowpos)
*----------------------------------------------------------
If m.bidim
colpos = m.colpos+1
If colpos > m.ncols
ncols = m.colpos
Endif
Dimension obj.&arrayName(m.rowpos,m.ncols)
obj.&arrayName(m.rowpos,m.colpos) = m.valasig
If Vartype(m.valasig) = 'O'
procstring(obj.&arrayName(m.rowpos,m.colpos))
Endif
Else
rowpos = m.rowpos+1
Dimension obj.&arrayName(m.rowpos)
obj.&arrayName(m.rowpos) = m.valasig
If Vartype(m.valasig) = 'O'
procstring(obj.&arrayName(m.rowpos))
Endif
Endif
*-----------------------------------------
Function unescunicode( Value )
*-----------------------------------------
noc=1
Do While .T.
posunicode = At('\u',m.value,m.noc)
If m.posunicode = 0
Return
Endif
If Substr(m.value,m.posunicode-1,1) = '\' And Substr(m.value,m.posunicode-2,1) # '\'
noc=m.noc+1
Loop
Endif
nunic = Evaluate('0x'+ Substr(m.value,m.posunicode+2,4) )
If Between(m.nunic,0,255)
unicodec = Chr(m.nunic)
Else
unicodec = '&#'+Transform(m.nunic)+';'
Endif
Value = Stuff(m.value,m.posunicode,6,m.unicodec)
Enddo
*-----------------------------------
Function unescapecontrolc( Value )
*-----------------------------------
If At('\', m.value) = 0
Return
Endif
* unescape special characters:
Private aa,elem,unesc
Declare aa(1)
=Alines(m.aa,m.value,18,'\\','\b','\f','\n','\r','\t','\"','\/')
unesc =''
#Define sustb 'bnrt/"'
#Define sustr Chr(127)+Chr(10)+Chr(13)+Chr(9)+Chr(47)+Chr(34)
For Each elem In m.aa
If ! m.elem == '\\' And Right(m.elem,2) = '\'
elem = Left(m.elem,Len(m.elem)-2)+Chrtran(Right(m.elem,1),sustb,sustr)
Endif
unesc = m.unesc+m.elem
Endfor
Value = m.unesc
*--------------------------------------------
Procedure propertyName(obj)
*--------------------------------------------
vari=''
Do While ( Right(m.vari,1) # '"' Or ( Right(m.vari,2) = '\"' And Right(m.vari,3) # '\\"' ) ) And Alen(aj) > m.x
x=m.x+1
vari = m.vari+aj(m.x)
Enddo
If Right(m.vari,1) # '"'
Error ' expecting " received '+ Right(Rtrim(m.vari),1)
Endif
vari = Left(m.vari,Len(m.vari)-1)
vari = Iif(Isalpha(m.vari),'','_')+m.vari
vari = Chrtran( vari, Chrtran( vari, cvalid,'' ) , creem )
If vari = 'tabindex'
vari = '_tabindex'
Endif
expecting = ':'
expectingValue = .T.
expectingPropertyName = .F.
*-------------------------------------------------------------
Procedure procValue(obj)
*-------------------------------------------------------------
Do Case
Case aj(m.x) = '{'
oStack.pushObject()
If m.arrayLevel = 0
AddProperty(obj,m.vari,Createobject('empty'))
procstring(obj.&vari)
expectingPropertyName = .T.
expecting = ',}'
expectingValue = .F.
Else
anuevoel(m.obj,m.arrayName,Createobject('empty'),m.bidim,@colpos,@rowpos)
expectingPropertyName = .F.
expecting = ',]'
expectingValue = .T.
Endif
Case aj(x) = '['
oStack.pushArray()
Do Case
Case m.arrayLevel = 0
arrayName = Evl(m.vari,'array')
rowpos = 0
colpos = 0
bidim = .F.
#DEFINE EMPTYARRAYFLAG '_EMPTY_ARRAY_FLAG_'
Try
AddProperty(obj,(m.arrayName+'(1)'),EMPTYARRAYFLAG)
Catch
m.arrayName = m.arrayName+'_vfpSafe_'
AddProperty(obj,(m.arrayName+'(1)'),EMPTYARRAYFLAG)
Endtry
Case m.arrayLevel = 1 And !m.bidim
rowpos = 1
colpos = 0
ncols = 1
Dime obj.&arrayName(1,2)
bidim = .T.
Endcase
arrayLevel = m.arrayLevel+1
vari=''
expecting = Iif(!m.bidim,'[]{',']')
expectingValue = .T.
expectingPropertyName = .F.
Otherwise
isstring = aj(m.x)='"'
x = m.x + Iif(m.isstring,1,0)
Value = ''
Do While .T.
Value = m.value+m.aj(m.x)
If m.isstring
If Right(m.value,1) = '"' And ( Right(m.value,2) # '\"' Or Right(m.value,3) = '\\' )
Exit
Endif
Else
If Right(m.value,1) $ '}],' And ( Left(Right(m.value,2),1) # '\' Or Left(Right(Value,3),2) = '\\')
Exit
Endif
Endif
If m.x < Alen(aj)
x = m.x+1
Else
Exit
Endif
Enddo
closeChar = Right(m.value,1)
Value = Rtrim(m.value,1,m.closeChar)
If Empty(Value) And Not ( m.isstring And m.closeChar = '"' )
Error 'Expecting value received '+m.closeChar
Endif
Do Case
Case m.isstring
If m.closeChar # '"'
Error 'expecting " received '+m.closeChar
Endif
Case oStack.isObject() And Not m.closeChar $ ',}'
Error 'expecting ,} received '+m.closeChar
Case oStack.isArray() And Not m.closeChar $ ',]'
Error 'expecting ,] received '+m.closeChar
Endcase
If m.isstring
* don't change this lines sequence!:
unescunicode(@Value) && 1
unescapecontrolc(@Value) && 2
Value = Strtran(m.value,'\\','\') && 3
** check for Json Date:
If isJsonDt( m.value )
Value = jsonDateToDT( m.value )
Endif
Else
Value = Alltrim(m.value)
Do Case
Case m.value == 'null'
Value = .Null.
Case m.value == 'true' Or m.value == 'false'
Value = Value='true'
Case Empty(Chrtran(m.value,'-1234567890.E','')) And Occurs('.',m.value) <= 1 And Occurs('-',m.value) <= 1 And Occurs('E',m.value)<=1
If Not 'E' $ m.value
Value = Cast( m.value As N( Len(m.value) , Iif(At('.',m.value)>0,Len(m.value)-At( '.',m.value) ,0) ))
Endif
Otherwise
Error 'expecting "|number|null|true|false| received '+aj(m.x)
Endcase
Endif
If m.arrayLevel = 0
AddProperty(obj,m.vari,m.value)
expecting = '}'
expectingValue = .F.
expectingPropertyName = .T.
Else
anuevoel(obj,m.arrayName,m.value,m.bidim,@colpos,@rowpos)
expecting = ']'
expectingValue = .T.
expectingPropertyName = .F.
Endif
expecting = Iif(m.isstring,',','')+m.expecting
Do Case
Case m.closeChar = ']'
closeArray()
Case m.closeChar = '}'
closeObject()
Endcase
Endcase
*------------------------------
Function closeArray()
*------------------------------
If oStack.Pop() # 'A'
Error 'unexpected ] '
Endif
If m.arrayLevel = 0
Error 'unexpected ] '
Endif
arrayLevel = m.arrayLevel-1
If m.arrayLevel = 0
arrayName = ''
rowpos = 0
colpos = 0
expecting = Iif(oStack.isObject(),',}','')
expectingPropertyName = .T.
expectingValue = .F.
Else
If m.bidim
rowpos = m.rowpos+1
colpos = 0
expecting = ',]['
Else
expecting = ',]'
Endif
expectingValue = .T.
expectingPropertyName = .F.
Endif
*-------------------------------------
Procedure closeObject
*-------------------------------------
If oStack.Pop() # 'O'
Error 'unexpected }'
Endif
If m.arrayLevel = 0
expecting = ',}'
expectingValue = .F.
expectingPropertyName = .T.
objectOpen = .F.
Else
expecting = ',]'
expectingValue = .T.
expectingPropertyName = .F.
Endif
*----------------------------------------------
Function reviveCollection( o )
*----------------------------------------------
Private All
oConv = Createobject('empty')
nProp = Amembers(elem,m.o,0,'U')
For x = 1 To m.nProp
estaVar = m.elem(x)
esArray = .F.
esColeccion = Type('m.o.'+m.estaVar) = 'O' And Right( m.estaVar , 14 ) $ '_KV_COLLECTION,_KL_COLLECTION' And Type( 'm.o.'+m.estaVar+'.collectionitems',1) = 'A'
Do Case
Case m.esColeccion
estaProp = Createobject('collection')
tv = m.o.&estaVar
m.keyValColl = Right( m.estaVar , 14 ) = '_KV_COLLECTION'
For T = 1 To Alen(m.tv.collectionItems)
If m.keyValColl
esteval = m.tv.collectionItems(m.T).Value
Else
esteval = m.tv.collectionItems(m.T)
ENDIF
IF VARTYPE(m.esteval) = 'C' AND m.esteval = emptyarrayflag
loop
ENDIF
If Vartype(m.esteval) = 'O' Or Type('esteVal',1) = 'A'
esteval = reviveCollection(m.esteval)
Endif
If m.keyValColl
estaProp.Add(esteval,m.tv.collectionItems(m.T).Key)
Else
estaProp.Add(m.esteval)
Endif
Endfor
Case Type('m.o.'+m.estaVar,1) = 'A'
esArray = .T.
For T = 1 To Alen(m.o.&estaVar)
Dimension &estaVar(m.T)
If Type('m.o.&estaVar(m.T)') = 'O'
&estaVar(m.T) = reviveCollection(m.o.&estaVar(m.T))
Else
&estaVar(m.T) = m.o.&estaVar(m.T)
Endif
Endfor
Case Type('m.o.'+estaVar) = 'O'
estaProp = reviveCollection(m.o.&estaVar)
Otherwise
estaProp = m.o.&estaVar
Endcase
estaVar = Strtran( m.estaVar,'_KV_COLLECTION', '' )
estaVar = Strtran( m.estaVar, '_KL_COLLECTION', '' )
Do Case
Case m.esColeccion
AddProperty(m.oConv,m.estaVar,m.estaProp)
Case m.esArray
AddProperty(m.oConv,m.estaVar+'(1)')
Acopy(&estaVar,m.oConv.&estaVar)
Otherwise
AddProperty(m.oConv,m.estaVar,m.estaProp)
Endcase
Endfor
Try
retCollection = m.oConv.Collection.BaseClass = 'Collection'
Catch
retCollection = .F.
Endtry
If m.retCollection
Return m.oConv.Collection
Else
Return m.oConv
Endif
*----------------------------------
Function isJsonDt( cstr )
*----------------------------------
Return Iif( Len(m.cstr) = 19 ;
AND Len(Chrtran(m.cstr,'01234567890:T-','')) = 0 ;
and Substr(m.cstr,5,1) = '-' ;
and Substr(m.cstr,8,1) = '-' ;
and Substr(m.cstr,11,1) = 'T' ;
and Substr(m.cstr,14,1) = ':' ;
and Substr(m.cstr,17,1) = ':' ;
and Occurs('T',m.cstr) = 1 ;
and Occurs('-',m.cstr) = 2 ;
and Occurs(':',m.cstr) = 2 ,.T.,.F. )
*-----------------------------------
Procedure jsonDateToDT( cJsonDate )
*-----------------------------------
Return Eval("{^"+m.cJsonDate+"}")
******************************************
Define Class Stack As Collection
******************************************
*---------------------------
Function pushObject()
*---------------------------
This.Add('O')
*---------------------------
Function pushArray()
*---------------------------
This.Add('A')
*--------------------------------------
Function isObject()
*--------------------------------------
If This.Count > 0
Return This.Item( This.Count ) = 'O'
Else
Return .F.
Endif
*--------------------------------------
Function isArray()
*--------------------------------------
If This.Count > 0
Return This.Item( This.Count ) = 'A'
Else
Return .F.
Endif
*----------------------------
Function Pop()
*----------------------------
cret = This.Item( This.Count )
This.Remove( This.Count )
Return m.cret
******************************************
Enddefine
******************************************